* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL035744 |
| English Synonyms: | SYNTHON-LAB SL035744 |
| MDL Number.: | MFCD04087256 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | Cc1cc(c(n1c2cc(cc(c2)C(=O)O)C(=O)O)C)/C=C(\C#N)/C(=O)Nc3cccc(c3)OC |
| InChi: | InChI=1S/C25H21N3O6/c1-14-7-16(8-19(13-26)23(29)27-20-5-4-6-22(12-20)34-3)15(2)28(14)21-10-17(24(30)31)9-18(11-21)25(32)33/h4-12H,1-3H3,(H,27,29)(H,30,31)(H,32,33)/b19-8+ |
| InChiKey: | InChIKey=KHAZNSNAYQYKTH-UFWORHAWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.