* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL036000 |
| English Synonyms: | SYNTHON-LAB SL036000 |
| MDL Number.: | MFCD04087276 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCOc1cc(ccc1O)/C=C\2/C(=O)NC(=S)N(C2=O)c3cccc(c3C)Cl |
| InChi: | InChI=1S/C20H17ClN2O4S/c1-3-27-17-10-12(7-8-16(17)24)9-13-18(25)22-20(28)23(19(13)26)15-6-4-5-14(21)11(15)2/h4-10,24H,3H2,1-2H3,(H,22,25,28)/b13-9- |
| InChiKey: | InChIKey=RKNAMSLPQDLZES-LCYFTJDESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.