* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL036089 |
| English Synonyms: | SYNTHON-LAB SL036089 |
| MDL Number.: | MFCD04087304 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)/N=C\2/NC(=O)/C(=C\c3cccn3c4cccc(c4)C(=O)O)/S2 |
| InChi: | InChI=1S/C21H15N3O3S/c25-19-18(28-21(23-19)22-15-7-2-1-3-8-15)13-17-10-5-11-24(17)16-9-4-6-14(12-16)20(26)27/h1-13H,(H,26,27)(H,22,23,25)/b18-13+ |
| InChiKey: | InChIKey=VEPCJXHVLQGSAD-QGOAFFKASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.