* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL036185 |
| English Synonyms: | SYNTHON-LAB SL036185 |
| MDL Number.: | MFCD04090402 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | CCOc1cc2c(cc1/C=C/3\C(=O)N(/C(=N/c4ccccc4)/S3)CCCN5CCOCC5)OCO2 |
| InChi: | InChI=1S/C26H29N3O5S/c1-2-32-21-17-23-22(33-18-34-23)15-19(21)16-24-25(30)29(10-6-9-28-11-13-31-14-12-28)26(35-24)27-20-7-4-3-5-8-20/h3-5,7-8,15-17H,2,6,9-14,18H2,1H3/b24-16+,27-26- |
| InChiKey: | InChIKey=DJJMZEYRPQUYQG-YCJCGMCGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.