* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL036634 |
| English Synonyms: | SYNTHON-LAB SL036634 |
| MDL Number.: | MFCD04090433 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCN1C(=O)/C(=C\c2ccc(o2)c3ccc(cc3C)C(=O)O)/NC1=O |
| InChi: | InChI=1S/C18H16N2O5/c1-3-20-16(21)14(19-18(20)24)9-12-5-7-15(25-12)13-6-4-11(17(22)23)8-10(13)2/h4-9H,3H2,1-2H3,(H,19,24)(H,22,23)/b14-9+ |
| InChiKey: | InChIKey=LXJDNNBQHDPHHV-NTEUORMPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.