* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL081044 |
| English Synonyms: | SYNTHON-LAB SL081044 |
| MDL Number.: | MFCD04090809 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | Cc1c(c([nH]n1)O)C(c2cn(c3c2cccc3)Cc4ccccc4Cl)c5c(n[nH]c5O)C |
| InChi: | InChI=1S/C24H22ClN5O2/c1-13-20(23(31)28-26-13)22(21-14(2)27-29-24(21)32)17-12-30(19-10-6-4-8-16(17)19)11-15-7-3-5-9-18(15)25/h3-10,12,22H,11H2,1-2H3,(H2,26,28,31)(H2,27,29,32) |
| InChiKey: | InChIKey=BSFXHEDVIBMBTQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.