* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL016434 |
| English Synonyms: | SYNTHON-LAB SL016434 |
| MDL Number.: | MFCD04090851 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | COc1ccc(cc1)n2c(nnc2SCC(=O)N3CCCC3)CCc4ccccc4 |
| InChi: | InChI=1S/C23H26N4O2S/c1-29-20-12-10-19(11-13-20)27-21(14-9-18-7-3-2-4-8-18)24-25-23(27)30-17-22(28)26-15-5-6-16-26/h2-4,7-8,10-13H,5-6,9,14-17H2,1H3 |
| InChiKey: | InChIKey=LJXPTBHAVLDZLD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.