Molecular Structure:
CCD No.:CCD00448347
BUTTPARK 140\40-31
Formula:C20 H14 N2 O2 S
MolWeight:346.409
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 140\40-31 |
| English Synonyms： | BUTTPARK 140\40-31 |
| MDL Number.： | MFCD04110563 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | c1ccc(cc1)c2cc3c(s2)ncn(c3=O)CC(=O)c4ccccc4 |
| InChi： | InChI=1S/C20H14N2O2S/c23-17(14-7-3-1-4-8-14)12-22-13-21-19-16(20(22)24)11-18(25-19)15-9-5-2-6-10-15/h1-11,13H,12H2 |
| InChiKey： | InChIKey=BOSXNAOMQROTFG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
