Molecular Structure:
CCD No.:CCD00448355
BUTTPARK 140\40-59
Formula:C20 H16 Cl2 N2 O3 S
MolWeight:435.329
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 140\40-59 |
| English Synonyms： | BUTTPARK 140\40-59 |
| MDL Number.： | MFCD04110574 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | CCOC(=O)c1cc(sc1NC(=O)Nc2ccc(c(c2)Cl)Cl)c3ccccc3 |
| InChi： | InChI=1S/C20H16Cl2N2O3S/c1-2-27-19(25)14-11-17(12-6-4-3-5-7-12)28-18(14)24-20(26)23-13-8-9-15(21)16(22)10-13/h3-11H,2H2,1H3,(H2,23,24,26) |
| InChiKey： | InChIKey=VGLTZTPCYPTRTJ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
