* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-FLUORO-10,11-DIHYDRO-BENZO[4,5]CYCLOHEPTA[1,2-B]PYRIDIN-5-ONE |
| CAS: | 710348-89-3 |
| English Synonyms: | 8-FLUORO-10,11-DIHYDRO-BENZO[4,5]CYCLOHEPTA[1,2-B]PYRIDIN-5-ONE |
| MDL Number.: | MFCD04114393 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cc2c(nc1)CCc3cc(ccc3C2=O)F |
| InChi: | InChI=1S/C14H10FNO/c15-10-4-5-11-9(8-10)3-6-13-12(14(11)17)2-1-7-16-13/h1-2,4-5,7-8H,3,6H2 |
| InChiKey: | InChIKey=PVYLZBOCBZTZDG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.