* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(1-METHYL-1,2,3,6-TETRAHYDRO-PYRIDIN-4-YL)-1H-INDAZOLE |
| CAS: | 885272-32-2 |
| English Synonyms: | 6-(1-METHYL-1,2,3,6-TETRAHYDRO-PYRIDIN-4-YL)-1H-INDAZOLE |
| MDL Number.: | MFCD04114673 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CN1CCC(=CC1)c2ccc3cn[nH]c3c2 |
| InChi: | InChI=1S/C13H15N3/c1-16-6-4-10(5-7-16)11-2-3-12-9-14-15-13(12)8-11/h2-4,8-9H,5-7H2,1H3,(H,14,15) |
| InChiKey: | InChIKey=OBQBTAVZHRCACI-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.