* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (R)-(-)-1-ISOCYANOINDANE |
| CAS: | 728920-02-3 |
| English Synonyms: | (R)-(-)-1-ISOCYANOINDANE |
| MDL Number.: | MFCD04117510 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | [C-]#[N+][C@@H]1CCc2c1cccc2 |
| InChi: | InChI=1S/C10H9N/c1-11-10-7-6-8-4-2-3-5-9(8)10/h2-5,10H,6-7H2/t10-/m1/s1 |
| InChiKey: | InChIKey=KNXCHLLQHRSRIT-SNVBAGLBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.