Molecular Structure:
CCD No.:CCD00453064
DIETHYL OXALATE-13C2
CAS No.:
150992-84-0
Formula:C6 H10 O4
MolWeight:148.119
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | DIETHYL OXALATE-13C2 |
| CAS： | 150992-84-0 |
| English Synonyms： | DIETHYL OXALATE-13C2 |
| MDL Number.： | MFCD04118134 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | CCO[13C](=O)[13C](=O)OCC |
| InChi： | InChI=1S/C6H10O4/c1-3-9-5(7)6(8)10-4-2/h3-4H2,1-2H3/i5+1,6+1 |
| InChiKey： | InChIKey=WYACBZDAHNBPPB-MPOCSFTDSA-N |
|
|
| Boiling Point： | 185 DEG C(LIT) |
| Density： | DENSITY: 1.091 G/ML AT 25 DEG C |
| Physical Property： | FLASHPOINT: 167 DEG F FLASHPOINT: 75 DEG C |
| Comments： | MASS SHIFT: M+2 RIDADR: UN 2525 6.1/PG 3 UNSPSC: 12142200 WGK: 1 |
| Information： | ISOTOPIC PURITY: 99 ATOM % 13C MW: 148.11 BY ATOM % CALCULATION |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
