* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DL-MALIC ACID-2-13C |
| CAS: | 143435-96-5 |
| English Synonyms: | DL-MALIC ACID-2-13C |
| MDL Number.: | MFCD04118144 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | C([13CH](C(=O)O)O)C(=O)O |
| InChi: | InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/i2+1 |
| InChiKey: | InChIKey=BJEPYKJPYRNKOW-VQEHIDDOSA-N |
|
|
| Melting Point: | 131-133 DEG C(LIT) |
| Comments: | MASS SHIFT: M+1 WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 135.08 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.