* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLYCOLIC ACID-1-13C |
| English Synonyms: | GLYCOLIC ACID-1-13C ; HYDROXYACETIC ACID-1-13C |
| MDL Number.: | MFCD04118145 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C([13C](=O)O)O |
| InChi: | InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)/i2+1 |
| InChiKey: | InChIKey=AEMRFAOFKBGASW-VQEHIDDOSA-N |
|
|
| Comments: | MASS SHIFT: M+1 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 77.04 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.