* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | GLYCOLIC ACID-13C2 |
CAS: | 111389-68-5 |
English Synonyms: | HYDROXYACETIC ACID-13C2 ; GLYCOLIC ACID-13C2 |
MDL Number.: | MFCD04118149 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | [13CH2]([13C](=O)O)O |
InChi: | InChI=1S/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)/i1+1,2+1 |
InChiKey: | InChIKey=AEMRFAOFKBGASW-ZDOIIHCHSA-N |
|
|
Comments: | MASS SHIFT: M+2 WGK: 1 |
Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 78.02 BY ATOM % CALCULATION |
|
* If the product has intellectual property rights, a license granted is must or contact us.