* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DL-TRYPTOPHAN-2-13C |
| English Synonyms: | DL-TRYPTOPHAN-2-13C |
| MDL Number.: | MFCD04118170 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1ccc2c(c1)c(c[nH]2)C[13CH](C(=O)O)N |
| InChi: | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/i9+1 |
| InChiKey: | InChIKey=QIVBCDIJIAJPQS-QBZHADDCSA-N |
|
|
| Melting Point: | 289-290 DEG C(LIT) |
| Comments: | MASS SHIFT: M+1 WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 205.22 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.