* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GRANDLURE |
CAS: | 11104-05-5 |
English Synonyms: | GRANDLURE |
MDL Number.: | MFCD04119712 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC(C)[C@@H]1CC[C@]1(C)CCO.CC1(CCC/C(=C/CO)/C1)C.CC1(CCC/C(=C\C=O)/C1)C |
InChi: | InChI=1S/C10H20O.C10H18O.C10H16O/c1-8(2)9-4-5-10(9,3)6-7-11;2*1-10(2)6-3-4-9(8-10)5-7-11/h8-9,11H,4-7H2,1-3H3;5,11H,3-4,6-8H2,1-2H3;5,7H,3-4,6,8H2,1-2H3/b;9-5-;9-5+/t9-,10+;;/m0../s1 |
InChiKey: | InChIKey=AEISOAJMZNBCJG-PMHSJTGRSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.