* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL038252 |
| English Synonyms: | SYNTHON-LAB SL038252 |
| MDL Number.: | MFCD04127840 |
| H bond acceptor: | 9 |
| H bond donor: | 0 |
| Smile: | COC(=O)c1ccccc1c2ccc(o2)/C=C/3\C(=O)N(C(=O)S3)CC(=O)N4CCOCC4 |
| InChi: | InChI=1S/C22H20N2O7S/c1-29-21(27)16-5-3-2-4-15(16)17-7-6-14(31-17)12-18-20(26)24(22(28)32-18)13-19(25)23-8-10-30-11-9-23/h2-7,12H,8-11,13H2,1H3/b18-12+ |
| InChiKey: | InChIKey=KPHHZXLCQLLHCS-LDADJPATSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.