* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL038020 |
| English Synonyms: | SYNTHON-LAB SL038020 |
| MDL Number.: | MFCD04127949 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | Cc1cccc(c1)NC(=O)CN2C(=O)/C(=C\c3cccn3c4ccc(cc4)C(=O)O)/NC2=O |
| InChi: | InChI=1S/C24H20N4O5/c1-15-4-2-5-17(12-15)25-21(29)14-28-22(30)20(26-24(28)33)13-19-6-3-11-27(19)18-9-7-16(8-10-18)23(31)32/h2-13H,14H2,1H3,(H,25,29)(H,26,33)(H,31,32)/b20-13+ |
| InChiKey: | InChIKey=AIPXNIAMQAKLQH-DEDYPNTBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.