* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL085189 |
| English Synonyms: | SYNTHON-LAB SL085189 |
| MDL Number.: | MFCD04127964 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCc1ccc(cc1)OC(C)c2nnc(n2CC)SCC(=O)Nc3ccc(cc3)C(C)C |
| InChi: | InChI=1S/C25H32N4O2S/c1-6-19-8-14-22(15-9-19)31-18(5)24-27-28-25(29(24)7-2)32-16-23(30)26-21-12-10-20(11-13-21)17(3)4/h8-15,17-18H,6-7,16H2,1-5H3,(H,26,30) |
| InChiKey: | InChIKey=YVLDPOGFVUNNLJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.