* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL086177 |
| English Synonyms: | SYNTHON-LAB SL086177 |
| MDL Number.: | MFCD04128059 |
| H bond acceptor: | 9 |
| H bond donor: | 3 |
| Smile: | CC(c1nnc(n1C)SCC(=O)Nc2ccc(cc2)C(=O)O)NC(=O)c3ccccc3 |
| InChi: | InChI=1S/C21H21N5O4S/c1-13(22-19(28)14-6-4-3-5-7-14)18-24-25-21(26(18)2)31-12-17(27)23-16-10-8-15(9-11-16)20(29)30/h3-11,13H,12H2,1-2H3,(H,22,28)(H,23,27)(H,29,30) |
| InChiKey: | InChIKey=YIEBUGNMTXCWNO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.