* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL084529 |
| English Synonyms: | SYNTHON-LAB SL084529 |
| MDL Number.: | MFCD04128195 |
| H bond acceptor: | 10 |
| H bond donor: | 2 |
| Smile: | Cc1c(nc(s1)NC(=O)CSc2nnc(n2C)CNC(=O)c3ccc(c(c3)OC)OC)c4ccccc4 |
| InChi: | InChI=1S/C25H26N6O4S2/c1-15-22(16-8-6-5-7-9-16)28-24(37-15)27-21(32)14-36-25-30-29-20(31(25)2)13-26-23(33)17-10-11-18(34-3)19(12-17)35-4/h5-12H,13-14H2,1-4H3,(H,26,33)(H,27,28,32) |
| InChiKey: | InChIKey=JTFQJFXTZYTSBR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.