* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL085713 |
| English Synonyms: | SYNTHON-LAB SL085713 |
| MDL Number.: | MFCD04128257 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | Cn1c(nnc1SCC(=O)Nc2ccc(c(c2)C(=O)OC)Cl)Cc3ccc(cc3)OC |
| InChi: | InChI=1S/C21H21ClN4O4S/c1-26-18(10-13-4-7-15(29-2)8-5-13)24-25-21(26)31-12-19(27)23-14-6-9-17(22)16(11-14)20(28)30-3/h4-9,11H,10,12H2,1-3H3,(H,23,27) |
| InChiKey: | InChIKey=RRHNXYFXHRBDCX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.