* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL037771 |
| English Synonyms: | SYNTHON-LAB SL037771 |
| MDL Number.: | MFCD04141607 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1cc(cc(c1)n2cccc2/C=N/NC(=O)c3ccc(cc3F)C#N)C(F)(F)F |
| InChi: | InChI=1S/C20H12F4N4O/c21-18-9-13(11-25)6-7-17(18)19(29)27-26-12-16-5-2-8-28(16)15-4-1-3-14(10-15)20(22,23)24/h1-10,12H,(H,27,29)/b26-12+ |
| InChiKey: | InChIKey=HBOUJOUZLYYGKR-RPPGKUMJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.