* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL053869 |
| English Synonyms: | SYNTHON-LAB SL053869 |
| MDL Number.: | MFCD04210616 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCc1cccc(c1NC(=O)COc2ccc(cc2)N3CC(CC3=O)C(=O)NCc4ccc(cc4)OC)C |
| InChi: | InChI=1S/C30H33N3O5/c1-4-22-7-5-6-20(2)29(22)32-27(34)19-38-26-14-10-24(11-15-26)33-18-23(16-28(33)35)30(36)31-17-21-8-12-25(37-3)13-9-21/h5-15,23H,4,16-19H2,1-3H3,(H,31,36)(H,32,34) |
| InChiKey: | InChIKey=JJPKXWQXTBOHAY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.