* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL085751 |
| English Synonyms: | SYNTHON-LAB SL085751 |
| MDL Number.: | MFCD04218466 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | COc1ccc(cc1)Cc2nnc(n2CC=C)SCC(=O)Nc3cc(cc(c3)Cl)Cl |
| InChi: | InChI=1S/C21H20Cl2N4O2S/c1-3-8-27-19(9-14-4-6-18(29-2)7-5-14)25-26-21(27)30-13-20(28)24-17-11-15(22)10-16(23)12-17/h3-7,10-12H,1,8-9,13H2,2H3,(H,24,28) |
| InChiKey: | InChIKey=IIVPOAZPTIXVBX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.