* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL051835 |
| English Synonyms: | SYNTHON-LAB SL051835 |
| MDL Number.: | MFCD04218861 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | CNC(=O)C(=O)NCCc1c[nH]c2c1cccc2 |
| InChi: | InChI=1S/C13H15N3O2/c1-14-12(17)13(18)15-7-6-9-8-16-11-5-3-2-4-10(9)11/h2-5,8,16H,6-7H2,1H3,(H,14,17)(H,15,18) |
| InChiKey: | InChIKey=ZLQVQQATLHCQON-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.