* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL051862 |
| English Synonyms: | SYNTHON-LAB SL051862 |
| MDL Number.: | MFCD04219103 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | c1ccc2c(c1)c(c[nH]2)CCNC(=O)C(=O)Nc3ccc4c(c3)OCO4 |
| InChi: | InChI=1S/C19H17N3O4/c23-18(19(24)22-13-5-6-16-17(9-13)26-11-25-16)20-8-7-12-10-21-15-4-2-1-3-14(12)15/h1-6,9-10,21H,7-8,11H2,(H,20,23)(H,22,24) |
| InChiKey: | InChIKey=ZQMALHNGNXVHER-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.