* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL051614 |
| English Synonyms: | SYNTHON-LAB SL051614 |
| MDL Number.: | MFCD04225545 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | Cc1cccc(c1NC(=O)C(=O)NCCCOC(C)C)C |
| InChi: | InChI=1S/C16H24N2O3/c1-11(2)21-10-6-9-17-15(19)16(20)18-14-12(3)7-5-8-13(14)4/h5,7-8,11H,6,9-10H2,1-4H3,(H,17,19)(H,18,20) |
| InChiKey: | InChIKey=ZRUWBGSSVPUOOK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.