* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL051767 |
| English Synonyms: | SYNTHON-LAB SL051767 |
| MDL Number.: | MFCD04225650 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)N2CC(CC2=O)C(=O)Nc3ccccc3C(=O)NC4CCCCC4 |
| InChi: | InChI=1S/C24H27N3O3/c28-22-15-17(16-27(22)19-11-5-2-6-12-19)23(29)26-21-14-8-7-13-20(21)24(30)25-18-9-3-1-4-10-18/h2,5-8,11-14,17-18H,1,3-4,9-10,15-16H2,(H,25,30)(H,26,29) |
| InChiKey: | InChIKey=UTLUGJQOZJYJFS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.