* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB025611 |
| English Synonyms: | VITAS-BB TBB025611 |
| MDL Number.: | MFCD04226570 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)C1=C(NC(=O)C2=CC3=C(OC2=N)C=CC2=C3C=CC=C2)SC(C(=O)N(C)C)=C1C |
| InChi: | InChI=1S/C25H23N3O5S/c1-5-32-25(31)19-13(2)20(24(30)28(3)4)34-23(19)27-22(29)17-12-16-15-9-7-6-8-14(15)10-11-18(16)33-21(17)26/h6-12,26H,5H2,1-4H3,(H,27,29) |
| InChiKey: | InChIKey=JVXPELMFJIPCOO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.