* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB025627 |
| English Synonyms: | VITAS-BB TBB025627 |
| MDL Number.: | MFCD04226584 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | COC(=O)C1=C(NC(=O)C2=CC3=C(OC2=N)C2=C(C=CC=C2)C=C3)SC(C(N)=O)=C1C |
| InChi: | InChI=1S/C22H17N3O5S/c1-10-15(22(28)29-2)21(31-17(10)18(23)26)25-20(27)14-9-12-8-7-11-5-3-4-6-13(11)16(12)30-19(14)24/h3-9,24H,1-2H3,(H2,23,26)(H,25,27) |
| InChiKey: | InChIKey=CJKRGJATXIYNBP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.