* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB025609 |
| English Synonyms: | VITAS-BB TBB025609 |
| MDL Number.: | MFCD04226596 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | COC1=CC=CC2=C1OC(=N)C(=C2)C(=O)NC1=C(C#N)C2=C(CCCC2)S1 |
| InChi: | InChI=1S/C20H17N3O3S/c1-25-15-7-4-5-11-9-13(18(22)26-17(11)15)19(24)23-20-14(10-21)12-6-2-3-8-16(12)27-20/h4-5,7,9,22H,2-3,6,8H2,1H3,(H,23,24) |
| InChiKey: | InChIKey=RMSAIUNAICZCSA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.