* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB025610 |
| English Synonyms: | VITAS-BB TBB025610 |
| MDL Number.: | MFCD04226602 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)NC1=C(C#N)C3=C(CCCC3)S1)C(=N)O2 |
| InChi: | InChI=1S/C23H24N4O2S/c1-3-27(4-2)15-10-9-14-11-17(21(25)29-19(14)12-15)22(28)26-23-18(13-24)16-7-5-6-8-20(16)30-23/h9-12,25H,3-8H2,1-2H3,(H,26,28) |
| InChiKey: | InChIKey=QXSLDLUDYDTBRN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.