* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB025617 |
| English Synonyms: | VITAS-BB TBB025617 |
| MDL Number.: | MFCD04226665 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCCC1=CC=C(C=C1)C(C)NC(=O)C1C2CCC(C1C(O)=O)C2=C(C)C |
| InChi: | InChI=1S/C23H31NO3/c1-5-6-15-7-9-16(10-8-15)14(4)24-22(25)20-17-11-12-18(19(17)13(2)3)21(20)23(26)27/h7-10,14,17-18,20-21H,5-6,11-12H2,1-4H3,(H,24,25)(H,26,27) |
| InChiKey: | InChIKey=NKEVONKMIIRLDD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.