* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB025567 |
| English Synonyms: | VITAS-BB TBB025567 |
| MDL Number.: | MFCD04226750 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | FC(F)C(F)(F)OC1=CC=CC(=C1)C(=O)N\N=C1\C(=O)NC2=C1C(Br)=CC=C2 |
| InChi: | InChI=1S/C17H10BrF4N3O3/c18-10-5-2-6-11-12(10)13(15(27)23-11)24-25-14(26)8-3-1-4-9(7-8)28-17(21,22)16(19)20/h1-7,16H,(H,25,26)(H,23,24,27) |
| InChiKey: | InChIKey=CLIDHILWAKIPNF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.