* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB025533 |
| English Synonyms: | VITAS-BB TBB025533 |
| MDL Number.: | MFCD04226898 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CC1=CC=CC=C1NS(=O)(=O)C1=CC=C(NC(=S)NC2=CC=C3OCOC3=C2)C=C1 |
| InChi: | InChI=1S/C21H19N3O4S2/c1-14-4-2-3-5-18(14)24-30(25,26)17-9-6-15(7-10-17)22-21(29)23-16-8-11-19-20(12-16)28-13-27-19/h2-12,24H,13H2,1H3,(H2,22,23,29) |
| InChiKey: | InChIKey=WWLMZZBLJGJQLN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.