* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL067141 |
| English Synonyms: | SYNTHON-LAB SL067141 |
| MDL Number.: | MFCD04230702 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CCCCCCCSc1nc2c(nn1)-c3ccccc3NC(O2)c4ccc(c(c4)O)O |
| InChi: | InChI=1S/C23H26N4O3S/c1-2-3-4-5-8-13-31-23-25-22-20(26-27-23)16-9-6-7-10-17(16)24-21(30-22)15-11-12-18(28)19(29)14-15/h6-7,9-12,14,21,24,28-29H,2-5,8,13H2,1H3 |
| InChiKey: | InChIKey=OQXASWCPKCASKJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.