* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL067423 |
| English Synonyms: | SYNTHON-LAB SL067423 |
| MDL Number.: | MFCD04230755 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCCCCCSc1nc2c(nn1)-c3cc(ccc3NC(O2)c4ccc(cc4)OCC(=O)O)Br |
| InChi: | InChI=1S/C24H25BrN4O4S/c1-2-3-4-5-12-34-24-27-23-21(28-29-24)18-13-16(25)8-11-19(18)26-22(33-23)15-6-9-17(10-7-15)32-14-20(30)31/h6-11,13,22,26H,2-5,12,14H2,1H3,(H,30,31) |
| InChiKey: | InChIKey=JJIVFSHRXATBLN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.