* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL068653 |
| English Synonyms: | SYNTHON-LAB SL068653 |
| MDL Number.: | MFCD04231037 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | CCc1ccc2c(c1)c3c([nH]2)nc(nn3)N/N=C/c4cccc(c4Cl)O |
| InChi: | InChI=1S/C18H15ClN6O/c1-2-10-6-7-13-12(8-10)16-17(21-13)22-18(25-23-16)24-20-9-11-4-3-5-14(26)15(11)19/h3-9,26H,2H2,1H3,(H2,21,22,24,25)/b20-9+ |
| InChiKey: | InChIKey=WFRJMUZQZWKAQN-AWQFTUOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.