* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL031901 |
| English Synonyms: | SYNTHON-LAB SL031901 |
| MDL Number.: | MFCD04307901 |
| H bond acceptor: | 10 |
| H bond donor: | 2 |
| Smile: | c1cc2c(cc1N3C(=O)/C(=C/c4cc(c(c(c4)Cl)OCC(=O)O)Cl)/C(=O)NC3=O)OCO2 |
| InChi: | InChI=1S/C20H12Cl2N2O8/c21-12-4-9(5-13(22)17(12)30-7-16(25)26)3-11-18(27)23-20(29)24(19(11)28)10-1-2-14-15(6-10)32-8-31-14/h1-6H,7-8H2,(H,25,26)(H,23,27,29)/b11-3+ |
| InChiKey: | InChIKey=WMFJPZJPUAAIEP-QDEBKDIKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.