* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL033554 |
| English Synonyms: | SYNTHON-LAB SL033554 |
| MDL Number.: | MFCD04307975 |
| H bond acceptor: | 10 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)N2CCN(CC2)C(=O)CN3C(=O)/C(=C\c4ccc(c(c4)[N+](=O)[O-])O)/SC3=O |
| InChi: | InChI=1S/C22H20N4O6S/c27-18-7-6-15(12-17(18)26(31)32)13-19-21(29)25(22(30)33-19)14-20(28)24-10-8-23(9-11-24)16-4-2-1-3-5-16/h1-7,12-13,27H,8-11,14H2/b19-13+ |
| InChiKey: | InChIKey=NJKCBVHSALEFJG-CPNJWEJPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.