* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034127 |
| English Synonyms: | SYNTHON-LAB SL034127 |
| MDL Number.: | MFCD04308006 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CC(C(=O)O)Oc1ccc(cc1OC)/C=C/2\C(=O)N(/C(=N/c3ccccc3)/S2)CCc4c[nH]c5c4cccc5 |
| InChi: | InChI=1S/C30H27N3O5S/c1-19(29(35)36)38-25-13-12-20(16-26(25)37-2)17-27-28(34)33(30(39-27)32-22-8-4-3-5-9-22)15-14-21-18-31-24-11-7-6-10-23(21)24/h3-13,16-19,31H,14-15H2,1-2H3,(H,35,36)/b27-17+,32-30- |
| InChiKey: | InChIKey=WPHNXQHKYUSFKZ-FLNDSNKGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.