* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034727 |
| English Synonyms: | SYNTHON-LAB SL034727 |
| MDL Number.: | MFCD04308088 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | c1ccc2c(c1)[nH]c(n2)Oc3ccc(o3)/C=N/NC(=O)c4cc(cc(c4O)Br)Br |
| InChi: | InChI=1S/C19H12Br2N4O4/c20-10-7-12(17(26)13(21)8-10)18(27)25-22-9-11-5-6-16(28-11)29-19-23-14-3-1-2-4-15(14)24-19/h1-9,26H,(H,23,24)(H,25,27)/b22-9+ |
| InChiKey: | InChIKey=LRVXICWCWHYTLA-LSFURLLWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.