* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034907 |
| English Synonyms: | SYNTHON-LAB SL034907 |
| MDL Number.: | MFCD04308109 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | c1cc(ccc1c2ccc(o2)/C=N/c3ccc4c(c3)OCO4)[N+](=O)[O-] |
| InChi: | InChI=1S/C18H12N2O5/c21-20(22)14-4-1-12(2-5-14)16-8-6-15(25-16)10-19-13-3-7-17-18(9-13)24-11-23-17/h1-10H,11H2/b19-10+ |
| InChiKey: | InChIKey=REDRKMOEGZLIEK-VXLYETTFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.