* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034993 |
| English Synonyms: | SYNTHON-LAB SL034993 |
| MDL Number.: | MFCD04308120 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCN\1C(=O)/C(=C\c2ccc(c(c2)OCC)OCC#C)/S/C1=N\c3ccc(cc3)N4CCCCC4 |
| InChi: | InChI=1S/C28H31N3O3S/c1-4-18-34-24-15-10-21(19-25(24)33-6-3)20-26-27(32)31(5-2)28(35-26)29-22-11-13-23(14-12-22)30-16-8-7-9-17-30/h1,10-15,19-20H,5-9,16-18H2,2-3H3/b26-20+,29-28- |
| InChiKey: | InChIKey=FAPKGQQSNATOIR-UVUXTFCJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.