* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL038605 |
| English Synonyms: | SYNTHON-LAB SL038605 |
| MDL Number.: | MFCD04326163 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cc(ccc1C(=O)N/N=C/c2ccc(cc2F)N3CCCC3)Cl |
| InChi: | InChI=1S/C18H17ClFN3O/c19-15-6-3-13(4-7-15)18(24)22-21-12-14-5-8-16(11-17(14)20)23-9-1-2-10-23/h3-8,11-12H,1-2,9-10H2,(H,22,24)/b21-12+ |
| InChiKey: | InChIKey=CLKHKUHLQORTAJ-CIAFOILYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.