* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL075895 |
| English Synonyms: | SYNTHON-LAB SL075895 |
| MDL Number.: | MFCD04329674 |
| H bond acceptor: | 9 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)c1ccc(cc1)NC(=O)CSc2nnc(n2C)c3cc4cccc(c4o3)OC |
| InChi: | InChI=1S/C23H22N4O5S/c1-4-31-22(29)14-8-10-16(11-9-14)24-19(28)13-33-23-26-25-21(27(23)2)18-12-15-6-5-7-17(30-3)20(15)32-18/h5-12H,4,13H2,1-3H3,(H,24,28) |
| InChiKey: | InChIKey=DFQAXEKINSIPCQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.