* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL079264 |
| English Synonyms: | SYNTHON-LAB SL079264 |
| MDL Number.: | MFCD04330178 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCn1c(nnc1SCC(=O)Nc2ccc(c(c2)C)Br)C(C)NC(=O)c3ccc(c(c3)Cl)Cl |
| InChi: | InChI=1S/C22H22BrCl2N5O2S/c1-4-30-20(13(3)26-21(32)14-5-8-17(24)18(25)10-14)28-29-22(30)33-11-19(31)27-15-6-7-16(23)12(2)9-15/h5-10,13H,4,11H2,1-3H3,(H,26,32)(H,27,31) |
| InChiKey: | InChIKey=PVKAKPLTHZUGKF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.